Title: | Ionization efficiency prediction and quantification of unidentified chemicals |
---|---|
Description: | MS2Quant harvests pre-trained xgbTree algorithm-based ionization efficiency prediction model. Using strucutral information (SMILES) or predicted fingerprints calculated with SIRIUS+CSI_FingerID software, ionization efficiency can be predicted. If calibrants have been measured together with suspects subject to quantification, predicted ionization efficiencies can be converted into measurement-specific response factors and concentration of unknown chemcals can be estimated. |
Authors: | Helen Sepman [aut, cre] |
Maintainer: | Helen Sepman <[email protected]> |
License: | `use_mit_license()`, `use_gpl3_license()` or friends to pick a license |
Version: | 1.1.0 |
Built: | 2025-02-01 03:42:20 UTC |
Source: | https://github.com/drewszabo/MS2Quant |
This function calculates isotopic abundance for a chemical based on SMILES notation. This number can later be used as a coefficient to multiply the area corresponding to a monoisotopic ion.
isotopedistribution(smiles)
isotopedistribution(smiles)
smiles |
SMILES notation of the compound |
isotopic abundance coefficient
isotopedistribution("CN1C=NC2=C1C(=O)N(C(=O)N2C)C")
isotopedistribution("CN1C=NC2=C1C(=O)N(C(=O)N2C)C")
This function calculates the linear regression parameters from specified x and y values. Additionally, it checks the linearity based on residuals. In case there exists a residual with absolute value higher than 10, the highest value x-y point will be removed and new linear regression is generated without it. At least 5 datapoints have to remain.
linear_regression(y, x, remove_lowest_conc = FALSE)
linear_regression(y, x, remove_lowest_conc = FALSE)
y |
y-values of the data corresponding to x-values |
x |
x-values of the data |
linear regression parameters (slope and intercept) as a list